C24H36FN — CID 177436022
(2E,4Z,6Z,8E)-N-butyl-4-fluoro-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-imine (PubChem CID 177436022) has the molecular formula C24H36FN and a molecular weight of 357.56 g/mol. Its IUPAC name is (2E,4Z,6Z,8E)-N-butyl-4-fluoro-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-imine.
| Compound Name | (2E,4Z,6Z,8E)-N-butyl-4-fluoro-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-imine |
|---|---|
| PubChem CID | 177436022 |
| Molecular Formula | C24H36FN |
| Molecular Weight | 357.56 g/mol |
| Exact Mass | 357.28 |
| IUPAC Name | (2E,4Z,6Z,8E)-N-butyl-4-fluoro-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-imine |
| SMILES | CCCC/N=C/C=C(C)/C(F)=C/C=C(C)\C=C\C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C24H36FN/c1-7-8-17-26-18-15-21(4)23(25)14-12-19(2)11-13-22-20(3)10-9-16-24(22,5)6/h11-15,18H,7-10,16-17H2,1-6H3/b13-11+,19-12-,21-15+,23-14-,26-18+ |
| InChIKey | VWDBDORVSNMWNX-BKBFPORFSA-N |
| XLogP | 7.69 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.56 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|