C22H28O2Se — CID 177436374
(E)-1-ethoxy-2-(1',7',7'-trimethylspiro[1,3-dihydroindene-2,3'-bicyclo[2.2.1]heptane]-2'-ylidene)selaniumylethenolate (PubChem CID 177436374) has the molecular formula C22H28O2Se and a molecular weight of 403.42 g/mol. Its IUPAC name is (E)-1-ethoxy-2-(1',7',7'-trimethylspiro[1,3-dihydroindene-2,3'-bicyclo[2.2.1]heptane]-2'-ylidene)selaniumylethenolate.
| Compound Name | (E)-1-ethoxy-2-(1',7',7'-trimethylspiro[1,3-dihydroindene-2,3'-bicyclo[2.2.1]heptane]-2'-ylidene)selaniumylethenolate |
|---|---|
| PubChem CID | 177436374 |
| Molecular Formula | C22H28O2Se |
| Molecular Weight | 403.42 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | (E)-1-ethoxy-2-(1',7',7'-trimethylspiro[1,3-dihydroindene-2,3'-bicyclo[2.2.1]heptane]-2'-ylidene)selaniumylethenolate |
| SMILES | CCO/C([O-])=C/[Se+]=C1/C2(Cc3ccccc3C2)C2CCC1(C)C2(C)C |
| InChI | InChI=1S/C22H28O2Se/c1-5-24-18(23)14-25-19-21(4)11-10-17(20(21,2)3)22(19)12-15-8-6-7-9-16(15)13-22/h6-9,14,17H,5,10-13H2,1-4H3/b18-14+ |
| InChIKey | DGAWLLCDVNCLPC-NBVRZTHBSA-N |
| XLogP | 3.30 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|