C22H29O2Se+ — CID 177436375
[(E)-2-ethoxy-2-hydroxyethenyl]-(1',7',7'-trimethylspiro[1,3-dihydroindene-2,3'-bicyclo[2.2.1]heptane]-2'-ylidene)selanium (PubChem CID 177436375) has the molecular formula C22H29O2Se+ and a molecular weight of 404.43 g/mol. Its IUPAC name is [(E)-2-ethoxy-2-hydroxyethenyl]-(1',7',7'-trimethylspiro[1,3-dihydroindene-2,3'-bicyclo[2.2.1]heptane]-2'-ylidene)selanium.
| Compound Name | [(E)-2-ethoxy-2-hydroxyethenyl]-(1',7',7'-trimethylspiro[1,3-dihydroindene-2,3'-bicyclo[2.2.1]heptane]-2'-ylidene)selanium |
|---|---|
| PubChem CID | 177436375 |
| Molecular Formula | C22H29O2Se+ |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | [(E)-2-ethoxy-2-hydroxyethenyl]-(1',7',7'-trimethylspiro[1,3-dihydroindene-2,3'-bicyclo[2.2.1]heptane]-2'-ylidene)selanium |
| SMILES | CCO/C(O)=C/[Se+]=C1/C2(Cc3ccccc3C2)C2CCC1(C)C2(C)C |
| InChI | InChI=1S/C22H28O2Se/c1-5-24-18(23)14-25-19-21(4)11-10-17(20(21,2)3)22(19)12-15-8-6-7-9-16(15)13-22/h6-9,14,17H,5,10-13H2,1-4H3/p+1/b18-14+ |
| InChIKey | DGAWLLCDVNCLPC-NBVRZTHBSA-O |
| XLogP | 4.50 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|