C21H26BrNO6S — CID 177436642
methyl (1S,2S,3S,4R)-7-(4-bromophenyl)sulfonyl-3-[(Z)-6-methoxy-6-oxohex-1-enyl]-7-azabicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 177436642) has the molecular formula C21H26BrNO6S and a molecular weight of 500.41 g/mol. Its IUPAC name is methyl (1S,2S,3S,4R)-7-(4-bromophenyl)sulfonyl-3-[(Z)-6-methoxy-6-oxohex-1-enyl]-7-azabicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | methyl (1S,2S,3S,4R)-7-(4-bromophenyl)sulfonyl-3-[(Z)-6-methoxy-6-oxohex-1-enyl]-7-azabicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 177436642 |
| Molecular Formula | C21H26BrNO6S |
| Molecular Weight | 500.41 g/mol |
| Exact Mass | 499.07 |
| IUPAC Name | methyl (1S,2S,3S,4R)-7-(4-bromophenyl)sulfonyl-3-[(Z)-6-methoxy-6-oxohex-1-enyl]-7-azabicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | COC(=O)CCC/C=C\[C@H]1[C@H](C(=O)OC)[C@@H]2CC[C@H]1N2S(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H26BrNO6S/c1-28-19(24)7-5-3-4-6-16-17-12-13-18(20(16)21(25)29-2)23(17)30(26,27)15-10-8-14(22)9-11-15/h4,6,8-11,16-18,20H,3,5,7,12-13H2,1-2H3/b6-4-/t16-,17-,18+,20+/m1/s1 |
| InChIKey | GWVXEVDKCCGXHL-KYUCBNGESA-N |
| XLogP | 3.29 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|