C11H21N3 — CID 177436667
N-[(E)-(2,8-dimethyl-8-azabicyclo[3.2.1]octan-3-ylidene)amino]-N-methylmethanamine (PubChem CID 177436667) has the molecular formula C11H21N3 and a molecular weight of 195.31 g/mol. Its IUPAC name is N-[(E)-(2,8-dimethyl-8-azabicyclo[3.2.1]octan-3-ylidene)amino]-N-methylmethanamine.
| Compound Name | N-[(E)-(2,8-dimethyl-8-azabicyclo[3.2.1]octan-3-ylidene)amino]-N-methylmethanamine |
|---|---|
| PubChem CID | 177436667 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | N-[(E)-(2,8-dimethyl-8-azabicyclo[3.2.1]octan-3-ylidene)amino]-N-methylmethanamine |
| SMILES | CC1/C(=N/N(C)C)CC2CCC1N2C |
| InChI | InChI=1S/C11H21N3/c1-8-10(12-13(2)3)7-9-5-6-11(8)14(9)4/h8-9,11H,5-7H2,1-4H3/b12-10+ |
| InChIKey | BBOIOGGDAZDTAE-ZRDIBKRKSA-N |
| XLogP | 1.41 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|