About (1E)-1-(3-methyl-2,4-dihydropyrimidin-5-ylidene)-N-phenylmethoxymethanamine
(1E)-1-(3-methyl-2,4-dihydropyrimidin-5-ylidene)-N-phenylmethoxymethanamine (PubChem CID 177436693) has the molecular formula C13H17N3O
and a molecular weight of 231.30 g/mol. Its IUPAC name is (1E)-1-(3-methyl-2,4-dihydropyrimidin-5-ylidene)-N-phenylmethoxymethanamine.
Molecular Properties
| Compound Name | (1E)-1-(3-methyl-2,4-dihydropyrimidin-5-ylidene)-N-phenylmethoxymethanamine |
| PubChem CID | 177436693 |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | (1E)-1-(3-methyl-2,4-dihydropyrimidin-5-ylidene)-N-phenylmethoxymethanamine |
| SMILES | CN1CN=C/C(=C/NOCc2ccccc2)C1 |
| InChI | InChI=1S/C13H17N3O/c1-16-9-13(7-14-11-16)8-15-17-10-12-5-3-2-4-6-12/h2-8,15H,9-11H2,1H3/b13-8- |
| InChIKey | GVCXTNXRYCNFEI-JYRVWZFOSA-N |
| XLogP | 1.57 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (1E)-1-(3-methyl-2,4-dihydropyrimidin-5-ylidene)-N-phenylmethoxymethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E)-1-(3-methyl-2,4-dihydropyrimidin-5-ylidene)-N-phenylmethoxymethanamine?
The IUPAC name of (1E)-1-(3-methyl-2,4-dihydropyrimidin-5-ylidene)-N-phenylmethoxymethanamine (CID 177436693) is (1E)-1-(3-methyl-2,4-dihydropyrimidin-5-ylidene)-N-phenylmethoxymethanamine.
What is the SMILES notation for (1E)-1-(3-methyl-2,4-dihydropyrimidin-5-ylidene)-N-phenylmethoxymethanamine?
The canonical SMILES for (1E)-1-(3-methyl-2,4-dihydropyrimidin-5-ylidene)-N-phenylmethoxymethanamine is CN1CN=C/C(=C/NOCc2ccccc2)C1.
What is the InChIKey of (1E)-1-(3-methyl-2,4-dihydropyrimidin-5-ylidene)-N-phenylmethoxymethanamine?
The InChIKey is GVCXTNXRYCNFEI-JYRVWZFOSA-N. The full InChI is InChI=1S/C13H17N3O/c1-16-9-13(7-14-11-16)8-15-17-10-12-5-3-2-4-6-12/h2-8,15H,9-11H2,1H3/b13-8-.
What are the key properties of (1E)-1-(3-methyl-2,4-dihydropyrimidin-5-ylidene)-N-phenylmethoxymethanamine?
(1E)-1-(3-methyl-2,4-dihydropyrimidin-5-ylidene)-N-phenylmethoxymethanamine has a molecular weight of 231.30 g/mol, XLogP of 1.57, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1E)-1-(3-methyl-2,4-dihydropyrimidin-5-ylidene)-N-phenylmethoxymethanamine is sourced from PubChem (CID 177436693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).