C25H22ClN7O2S — CID 177436735
N-[2-[[5-[(E)-2-(1,3-benzoxazol-2-yl)-2-cyanoethenyl]-4-chloro-1,3-thiazol-2-yl]diazenyl]-5-(diethylamino)phenyl]acetamide (PubChem CID 177436735) has the molecular formula C25H22ClN7O2S and a molecular weight of 520.02 g/mol. Its IUPAC name is N-[2-[[5-[(E)-2-(1,3-benzoxazol-2-yl)-2-cyanoethenyl]-4-chloro-1,3-thiazol-2-yl]diazenyl]-5-(diethylamino)phenyl]acetamide.
| Compound Name | N-[2-[[5-[(E)-2-(1,3-benzoxazol-2-yl)-2-cyanoethenyl]-4-chloro-1,3-thiazol-2-yl]diazenyl]-5-(diethylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 177436735 |
| Molecular Formula | C25H22ClN7O2S |
| Molecular Weight | 520.02 g/mol |
| Exact Mass | 519.12 |
| IUPAC Name | N-[2-[[5-[(E)-2-(1,3-benzoxazol-2-yl)-2-cyanoethenyl]-4-chloro-1,3-thiazol-2-yl]diazenyl]-5-(diethylamino)phenyl]acetamide |
| SMILES | CCN(CC)c1ccc(/N=N/c2nc(Cl)c(/C=C(\C#N)c3nc4ccccc4o3)s2)c(NC(C)=O)c1 |
| InChI | InChI=1S/C25H22ClN7O2S/c1-4-33(5-2)17-10-11-18(20(13-17)28-15(3)34)31-32-25-30-23(26)22(36-25)12-16(14-27)24-29-19-8-6-7-9-21(19)35-24/h6-13H,4-5H2,1-3H3,(H,28,34)/b16-12+,32-31+ |
| InChIKey | YBARKMYYEPWKFX-RRJPDVTPSA-N |
| XLogP | 7.22 |
| TPSA | 119.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.02 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|