C41H68O9 — CID 177437350
(2S)-4-[(E,2R,13R)-13-[(2R,5R)-5-[(2S,5R,6S)-6-decyl-5-hydroxyoxan-2-yl]oxolan-2-yl]-2,13-bis(methoxymethoxy)tridec-6-en-8-ynyl]-2-methyl-2H-furan-5-one (PubChem CID 177437350) has the molecular formula C41H68O9 and a molecular weight of 704.99 g/mol. Its IUPAC name is (2S)-4-[(E,2R,13R)-13-[(2R,5R)-5-[(2S,5R,6S)-6-decyl-5-hydroxyoxan-2-yl]oxolan-2-yl]-2,13-bis(methoxymethoxy)tridec-6-en-8-ynyl]-2-methyl-2H-furan-5-one.
| Compound Name | (2S)-4-[(E,2R,13R)-13-[(2R,5R)-5-[(2S,5R,6S)-6-decyl-5-hydroxyoxan-2-yl]oxolan-2-yl]-2,13-bis(methoxymethoxy)tridec-6-en-8-ynyl]-2-methyl-2H-furan-5-one |
|---|---|
| PubChem CID | 177437350 |
| Molecular Formula | C41H68O9 |
| Molecular Weight | 704.99 g/mol |
| Exact Mass | 704.49 |
| IUPAC Name | (2S)-4-[(E,2R,13R)-13-[(2R,5R)-5-[(2S,5R,6S)-6-decyl-5-hydroxyoxan-2-yl]oxolan-2-yl]-2,13-bis(methoxymethoxy)tridec-6-en-8-ynyl]-2-methyl-2H-furan-5-one |
| SMILES | CCCCCCCCCC[C@@H]1O[C@H]([C@H]2CC[C@H]([C@@H](CCCC#C/C=C/CCC[C@H](CC3=C[C@H](C)OC3=O)OCOC)OCOC)O2)CC[C@H]1O |
| InChI | InChI=1S/C41H68O9/c1-5-6-7-8-9-13-16-19-22-36-35(42)24-25-39(49-36)40-27-26-38(50-40)37(47-31-45-4)23-20-17-14-11-10-12-15-18-21-34(46-30-44-3)29-33-28-32(2)48-41(33)43/h10,12,28,32,34-40,42H,5-9,13,15-27,29-31H2,1-4H3/b12-10+/t32-,34+,35+,36-,37+,38+,39-,40+/m0/s1 |
| InChIKey | DCMNOMVFCSOGAI-WPTLXRLESA-N |
| XLogP | 8.11 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.99 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|