C22H28ClN3O5 — CID 177437903
dimethyl (2S)-2-[[(1S)-2-(tert-butylamino)-1-(2-chloroquinolin-3-yl)-2-oxoethyl]amino]pentanedioate (PubChem CID 177437903) has the molecular formula C22H28ClN3O5 and a molecular weight of 449.94 g/mol. Its IUPAC name is dimethyl (2S)-2-[[(1S)-2-(tert-butylamino)-1-(2-chloroquinolin-3-yl)-2-oxoethyl]amino]pentanedioate.
| Compound Name | dimethyl (2S)-2-[[(1S)-2-(tert-butylamino)-1-(2-chloroquinolin-3-yl)-2-oxoethyl]amino]pentanedioate |
|---|---|
| PubChem CID | 177437903 |
| Molecular Formula | C22H28ClN3O5 |
| Molecular Weight | 449.94 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | dimethyl (2S)-2-[[(1S)-2-(tert-butylamino)-1-(2-chloroquinolin-3-yl)-2-oxoethyl]amino]pentanedioate |
| SMILES | COC(=O)CC[C@H](N[C@H](C(=O)NC(C)(C)C)c1cc2ccccc2nc1Cl)C(=O)OC |
| InChI | InChI=1S/C22H28ClN3O5/c1-22(2,3)26-20(28)18(24-16(21(29)31-5)10-11-17(27)30-4)14-12-13-8-6-7-9-15(13)25-19(14)23/h6-9,12,16,18,24H,10-11H2,1-5H3,(H,26,28)/t16-,18-/m0/s1 |
| InChIKey | LSAJUJOYWYMDED-WMZOPIPTSA-N |
| XLogP | 2.93 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.94 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|