C17H24O3 — CID 177438397
(3'aS,4'S,6'R)-4',6'-dipropylspiro[1,3-dioxolane-2,7'-4,6-dihydro-3aH-indene]-5'-one (PubChem CID 177438397) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is (3'aS,4'S,6'R)-4',6'-dipropylspiro[1,3-dioxolane-2,7'-4,6-dihydro-3aH-indene]-5'-one.
| Compound Name | (3'aS,4'S,6'R)-4',6'-dipropylspiro[1,3-dioxolane-2,7'-4,6-dihydro-3aH-indene]-5'-one |
|---|---|
| PubChem CID | 177438397 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | (3'aS,4'S,6'R)-4',6'-dipropylspiro[1,3-dioxolane-2,7'-4,6-dihydro-3aH-indene]-5'-one |
| SMILES | CCC[C@@H]1C(=O)[C@@H](CCC)C2(OCCO2)C2=CC=C[C@H]21 |
| InChI | InChI=1S/C17H24O3/c1-3-6-13-12-8-5-9-14(12)17(19-10-11-20-17)15(7-4-2)16(13)18/h5,8-9,12-13,15H,3-4,6-7,10-11H2,1-2H3/t12-,13-,15+/m0/s1 |
| InChIKey | NTCXNWFFXBMQAA-KCQAQPDRSA-N |
| XLogP | 3.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |