C15H24O4 — CID 177438908
(2R)-2-[(2S)-2-hydroxy-4-oxodecyl]-2,3-dihydropyran-6-one (PubChem CID 177438908) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is (2R)-2-[(2S)-2-hydroxy-4-oxodecyl]-2,3-dihydropyran-6-one.
| Compound Name | (2R)-2-[(2S)-2-hydroxy-4-oxodecyl]-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 177438908 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | (2R)-2-[(2S)-2-hydroxy-4-oxodecyl]-2,3-dihydropyran-6-one |
| SMILES | CCCCCCC(=O)C[C@@H](O)C[C@H]1CC=CC(=O)O1 |
| InChI | InChI=1S/C15H24O4/c1-2-3-4-5-7-12(16)10-13(17)11-14-8-6-9-15(18)19-14/h6,9,13-14,17H,2-5,7-8,10-11H2,1H3/t13-,14-/m1/s1 |
| InChIKey | MTJSHJVDXLQQAR-ZIAGYGMSSA-N |
| XLogP | 2.54 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|