C23H19N3O2 — CID 177439598
(1S,7R,8E,10Z,12Z)-4,7-diphenyl-2,4,6-triazatricyclo[6.5.1.02,6]tetradeca-8,10,12-triene-3,5-dione (PubChem CID 177439598) has the molecular formula C23H19N3O2 and a molecular weight of 369.42 g/mol. Its IUPAC name is (1S,7R,8E,10Z,12Z)-4,7-diphenyl-2,4,6-triazatricyclo[6.5.1.02,6]tetradeca-8,10,12-triene-3,5-dione.
| Compound Name | (1S,7R,8E,10Z,12Z)-4,7-diphenyl-2,4,6-triazatricyclo[6.5.1.02,6]tetradeca-8,10,12-triene-3,5-dione |
|---|---|
| PubChem CID | 177439598 |
| Molecular Formula | C23H19N3O2 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | (1S,7R,8E,10Z,12Z)-4,7-diphenyl-2,4,6-triazatricyclo[6.5.1.02,6]tetradeca-8,10,12-triene-3,5-dione |
| SMILES | O=c1n(-c2ccccc2)c(=O)n2n1[C@@H]1/C=C\C=C/C=C(\C1)[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C23H19N3O2/c27-22-24(19-13-7-3-8-14-19)23(28)26-21(17-10-4-1-5-11-17)18-12-6-2-9-15-20(16-18)25(22)26/h1-15,20-21H,16H2/b6-2-,15-9-,18-12+/t20-,21+/m1/s1 |
| InChIKey | PTTDZNQZBWQPLJ-BEANWDKTSA-N |
| XLogP | 3.39 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |