C54H64N2O4Pt — CID 177439785
bis(4-[2-(4-ethynyl-2,5-dihexoxyphenyl)ethynyl]pyridine);platinum(2+) (PubChem CID 177439785) has the molecular formula C54H64N2O4Pt and a molecular weight of 1000.19 g/mol. Its IUPAC name is bis(4-[2-(4-ethynyl-2,5-dihexoxyphenyl)ethynyl]pyridine);platinum(2+).
| Compound Name | bis(4-[2-(4-ethynyl-2,5-dihexoxyphenyl)ethynyl]pyridine);platinum(2+) |
|---|---|
| PubChem CID | 177439785 |
| Molecular Formula | C54H64N2O4Pt |
| Molecular Weight | 1000.19 g/mol |
| Exact Mass | 999.45 |
| IUPAC Name | bis(4-[2-(4-ethynyl-2,5-dihexoxyphenyl)ethynyl]pyridine);platinum(2+) |
| SMILES | [C-]#Cc1cc(OCCCCCC)c(C#Cc2ccncc2)cc1OCCCCCC.[C-]#Cc1cc(OCCCCCC)c(C#Cc2ccncc2)cc1OCCCCCC.[Pt+2] |
| InChI | InChI=1S/2C27H32NO2.Pt/c2*1-4-7-9-11-19-29-26-22-25(14-13-23-15-17-28-18-16-23)27(21-24(26)6-3)30-20-12-10-8-5-2;/h2*15-18,21-22H,4-5,7-12,19-20H2,1-2H3;/q2*-1;+2 |
| InChIKey | RGRXOUAEZOHHFR-UHFFFAOYSA-N |
| XLogP | 12.67 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1000.19 |
| LogP ≤ 5 | 12.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|