About [[(Z)-3,3-dimethyl-1-(2-methylphenyl)but-1-en-2-yl]-methyl-phenylsilyl]methanol
[[(Z)-3,3-dimethyl-1-(2-methylphenyl)but-1-en-2-yl]-methyl-phenylsilyl]methanol (PubChem CID 177440455) has the molecular formula C21H28OSi
and a molecular weight of 324.54 g/mol. Its IUPAC name is [[(Z)-3,3-dimethyl-1-(2-methylphenyl)but-1-en-2-yl]-methyl-phenylsilyl]methanol.
Molecular Properties
| Compound Name | [[(Z)-3,3-dimethyl-1-(2-methylphenyl)but-1-en-2-yl]-methyl-phenylsilyl]methanol |
| PubChem CID | 177440455 |
| Molecular Formula | C21H28OSi |
| Molecular Weight | 324.54 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | [[(Z)-3,3-dimethyl-1-(2-methylphenyl)but-1-en-2-yl]-methyl-phenylsilyl]methanol |
| SMILES | Cc1ccccc1/C=C(/C(C)(C)C)[Si](C)(CO)c1ccccc1 |
| InChI | InChI=1S/C21H28OSi/c1-17-11-9-10-12-18(17)15-20(21(2,3)4)23(5,16-22)19-13-7-6-8-14-19/h6-15,22H,16H2,1-5H3/b20-15- |
| InChIKey | IIZCIWWIZIIEJN-HKWRFOASSA-N |
| XLogP | 4.48 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.54 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [[(Z)-3,3-dimethyl-1-(2-methylphenyl)but-1-en-2-yl]-methyl-phenylsilyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[(Z)-3,3-dimethyl-1-(2-methylphenyl)but-1-en-2-yl]-methyl-phenylsilyl]methanol?
The IUPAC name of [[(Z)-3,3-dimethyl-1-(2-methylphenyl)but-1-en-2-yl]-methyl-phenylsilyl]methanol (CID 177440455) is [[(Z)-3,3-dimethyl-1-(2-methylphenyl)but-1-en-2-yl]-methyl-phenylsilyl]methanol.
What is the SMILES notation for [[(Z)-3,3-dimethyl-1-(2-methylphenyl)but-1-en-2-yl]-methyl-phenylsilyl]methanol?
The canonical SMILES for [[(Z)-3,3-dimethyl-1-(2-methylphenyl)but-1-en-2-yl]-methyl-phenylsilyl]methanol is Cc1ccccc1/C=C(/C(C)(C)C)[Si](C)(CO)c1ccccc1.
What is the InChIKey of [[(Z)-3,3-dimethyl-1-(2-methylphenyl)but-1-en-2-yl]-methyl-phenylsilyl]methanol?
The InChIKey is IIZCIWWIZIIEJN-HKWRFOASSA-N. The full InChI is InChI=1S/C21H28OSi/c1-17-11-9-10-12-18(17)15-20(21(2,3)4)23(5,16-22)19-13-7-6-8-14-19/h6-15,22H,16H2,1-5H3/b20-15-.
What are the key properties of [[(Z)-3,3-dimethyl-1-(2-methylphenyl)but-1-en-2-yl]-methyl-phenylsilyl]methanol?
[[(Z)-3,3-dimethyl-1-(2-methylphenyl)but-1-en-2-yl]-methyl-phenylsilyl]methanol has a molecular weight of 324.54 g/mol, XLogP of 4.48, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [[(Z)-3,3-dimethyl-1-(2-methylphenyl)but-1-en-2-yl]-methyl-phenylsilyl]methanol is sourced from PubChem (CID 177440455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).