C24H44O3SiSn — CID 177440964
triethyl-[(1S)-1-[(2S,6R)-6-[(2S,5S)-5-(1-trimethylstannylethenyl)oxolan-2-yl]-3,6-dihydro-2H-pyran-2-yl]but-3-enoxy]silane (PubChem CID 177440964) has the molecular formula C24H44O3SiSn and a molecular weight of 527.41 g/mol. Its IUPAC name is triethyl-[(1S)-1-[(2S,6R)-6-[(2S,5S)-5-(1-trimethylstannylethenyl)oxolan-2-yl]-3,6-dihydro-2H-pyran-2-yl]but-3-enoxy]silane.
| Compound Name | triethyl-[(1S)-1-[(2S,6R)-6-[(2S,5S)-5-(1-trimethylstannylethenyl)oxolan-2-yl]-3,6-dihydro-2H-pyran-2-yl]but-3-enoxy]silane |
|---|---|
| PubChem CID | 177440964 |
| Molecular Formula | C24H44O3SiSn |
| Molecular Weight | 527.41 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | triethyl-[(1S)-1-[(2S,6R)-6-[(2S,5S)-5-(1-trimethylstannylethenyl)oxolan-2-yl]-3,6-dihydro-2H-pyran-2-yl]but-3-enoxy]silane |
| SMILES | C=CC[C@H](O[Si](CC)(CC)CC)[C@@H]1CC=C[C@H]([C@@H]2CC[C@@H](C(=C)[Sn](C)(C)C)O2)O1 |
| InChI | InChI=1S/C21H35O3Si.3CH3.Sn/c1-6-12-21(24-25(8-3,9-4)10-5)19-14-11-13-18(23-19)20-16-15-17(7-2)22-20;;;;/h6,11,13,17-21H,1-2,8-10,12,14-16H2,3-5H3;3*1H3;/t17-,18-,19+,20+,21+;;;;/m1..../s1 |
| InChIKey | PXXSHTSFMYTMRX-DNRVBMAGSA-N |
| XLogP | 6.65 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.41 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|