C11H10N2O2 — CID 177440990
N-[(E)-cyclopenta-1,3-dien-1-ylmethylideneamino]furan-2-carboxamide (PubChem CID 177440990) has the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. Its IUPAC name is N-[(E)-cyclopenta-1,3-dien-1-ylmethylideneamino]furan-2-carboxamide.
| Compound Name | N-[(E)-cyclopenta-1,3-dien-1-ylmethylideneamino]furan-2-carboxamide |
|---|---|
| PubChem CID | 177440990 |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | N-[(E)-cyclopenta-1,3-dien-1-ylmethylideneamino]furan-2-carboxamide |
| SMILES | O=C(N/N=C/C1=CC=CC1)c1ccco1 |
| InChI | InChI=1S/C11H10N2O2/c14-11(10-6-3-7-15-10)13-12-8-9-4-1-2-5-9/h1-4,6-8H,5H2,(H,13,14)/b12-8+ |
| InChIKey | VUVGYVNZVMMVLG-XYOKQWHBSA-N |
| XLogP | 1.88 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|