About CID 177441058
CID 177441058 (PubChem CID 177441058) has the molecular formula C37H18Cl8N
and a molecular weight of 760.18 g/mol.
Molecular Properties
| Compound Name | CID 177441058 |
| PubChem CID | 177441058 |
| Molecular Formula | C37H18Cl8N |
| Molecular Weight | 760.18 g/mol |
| Exact Mass | 755.89 |
| IUPAC Name | — |
| SMILES | Clc1cc(Cl)c([C](c2c(Cl)cc(Cl)cc2Cl)c2c(Cl)cc(-n3c4ccccc4c4cc(-c5ccccc5)ccc43)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C37H18Cl8N/c38-21-13-26(40)34(27(41)14-21)37(35-28(42)15-22(39)16-29(35)43)36-30(44)17-23(18-31(36)45)46-32-9-5-4-8-24(32)25-12-20(10-11-33(25)46)19-6-2-1-3-7-19/h1-18H |
| InChIKey | SCDMNOIHAGQWBX-UHFFFAOYSA-N |
| XLogP | 14.70 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 760.18 |
| LogP ≤ 5 | 14.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze CID 177441058 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177441058?
The IUPAC name of CID 177441058 (CID 177441058) is not available.
What is the SMILES notation for CID 177441058?
The canonical SMILES for CID 177441058 is Clc1cc(Cl)c([C](c2c(Cl)cc(Cl)cc2Cl)c2c(Cl)cc(-n3c4ccccc4c4cc(-c5ccccc5)ccc43)cc2Cl)c(Cl)c1.
What is the InChIKey of CID 177441058?
The InChIKey is SCDMNOIHAGQWBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C37H18Cl8N/c38-21-13-26(40)34(27(41)14-21)37(35-28(42)15-22(39)16-29(35)43)36-30(44)17-23(18-31(36)45)46-32-9-5-4-8-24(32)25-12-20(10-11-33(25)46)19-6-2-1-3-7-19/h1-18H.
What are the key properties of CID 177441058?
CID 177441058 has a molecular weight of 760.18 g/mol, XLogP of 14.70, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177441058 is sourced from PubChem (CID 177441058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).