C25H20ClF2N5O10S — CID 177441351
[1-(4-chloro-3-nitrophenyl)sulfonylindol-3-yl]methyl N-[1-[(2R,4S,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]carbamate (PubChem CID 177441351) has the molecular formula C25H20ClF2N5O10S and a molecular weight of 655.98 g/mol. Its IUPAC name is [1-(4-chloro-3-nitrophenyl)sulfonylindol-3-yl]methyl N-[1-[(2R,4S,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]carbamate.
| Compound Name | [1-(4-chloro-3-nitrophenyl)sulfonylindol-3-yl]methyl N-[1-[(2R,4S,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 177441351 |
| Molecular Formula | C25H20ClF2N5O10S |
| Molecular Weight | 655.98 g/mol |
| Exact Mass | 655.06 |
| IUPAC Name | [1-(4-chloro-3-nitrophenyl)sulfonylindol-3-yl]methyl N-[1-[(2R,4S,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]carbamate |
| SMILES | O=C(Nc1ccn([C@@H]2O[C@H](CO)[C@H](O)C2(F)F)c(=O)n1)OCc1cn(S(=O)(=O)c2ccc(Cl)c([N+](=O)[O-])c2)c2ccccc12 |
| InChI | InChI=1S/C25H20ClF2N5O10S/c26-16-6-5-14(9-18(16)33(38)39)44(40,41)32-10-13(15-3-1-2-4-17(15)32)12-42-24(37)30-20-7-8-31(23(36)29-20)22-25(27,28)21(35)19(11-34)43-22/h1-10,19,21-22,34-35H,11-12H2,(H,29,30,36,37)/t19-,21+,22-/m1/s1 |
| InChIKey | MCTOWPBRXMNSLN-BAGYTPMASA-N |
| XLogP | 2.63 |
| TPSA | 205.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.98 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|