C13H8F8N2O3S — CID 177442586
quinolin-1-ium-1-yl-[1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoroethoxy)ethyl]sulfonylazanide (PubChem CID 177442586) has the molecular formula C13H8F8N2O3S and a molecular weight of 424.27 g/mol. Its IUPAC name is quinolin-1-ium-1-yl-[1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoroethoxy)ethyl]sulfonylazanide.
| Compound Name | quinolin-1-ium-1-yl-[1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoroethoxy)ethyl]sulfonylazanide |
|---|---|
| PubChem CID | 177442586 |
| Molecular Formula | C13H8F8N2O3S |
| Molecular Weight | 424.27 g/mol |
| Exact Mass | 424.01 |
| IUPAC Name | quinolin-1-ium-1-yl-[1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoroethoxy)ethyl]sulfonylazanide |
| SMILES | O=S(=O)([N-][n+]1cccc2ccccc21)C(F)(F)C(F)(F)OC(F)(F)C(F)F |
| InChI | InChI=1S/C13H8F8N2O3S/c14-10(15)11(16,17)26-12(18,19)13(20,21)27(24,25)22-23-7-3-5-8-4-1-2-6-9(8)23/h1-7,10H |
| InChIKey | YORWACCYDWCYQP-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 61.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.27 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|