About 2-[(1R,5Z)-5-(carbamoylhydrazinylidene)-4-methylcyclohex-3-en-1-yl]propan-2-yl acetate
2-[(1R,5Z)-5-(carbamoylhydrazinylidene)-4-methylcyclohex-3-en-1-yl]propan-2-yl acetate (PubChem CID 177442860) has the molecular formula C13H21N3O3
and a molecular weight of 267.33 g/mol. Its IUPAC name is 2-[(1R,5Z)-5-(carbamoylhydrazinylidene)-4-methylcyclohex-3-en-1-yl]propan-2-yl acetate.
Molecular Properties
| Compound Name | 2-[(1R,5Z)-5-(carbamoylhydrazinylidene)-4-methylcyclohex-3-en-1-yl]propan-2-yl acetate |
| PubChem CID | 177442860 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 2-[(1R,5Z)-5-(carbamoylhydrazinylidene)-4-methylcyclohex-3-en-1-yl]propan-2-yl acetate |
| SMILES | CC(=O)OC(C)(C)[C@@H]1CC=C(C)/C(=N\NC(N)=O)C1 |
| InChI | InChI=1S/C13H21N3O3/c1-8-5-6-10(13(3,4)19-9(2)17)7-11(8)15-16-12(14)18/h5,10H,6-7H2,1-4H3,(H3,14,16,18)/b15-11-/t10-/m1/s1 |
| InChIKey | ODUCHEWAJOSSMP-BXSDCGNMSA-N |
| XLogP | 1.71 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1R,5Z)-5-(carbamoylhydrazinylidene)-4-methylcyclohex-3-en-1-yl]propan-2-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1R,5Z)-5-(carbamoylhydrazinylidene)-4-methylcyclohex-3-en-1-yl]propan-2-yl acetate?
The IUPAC name of 2-[(1R,5Z)-5-(carbamoylhydrazinylidene)-4-methylcyclohex-3-en-1-yl]propan-2-yl acetate (CID 177442860) is 2-[(1R,5Z)-5-(carbamoylhydrazinylidene)-4-methylcyclohex-3-en-1-yl]propan-2-yl acetate.
What is the SMILES notation for 2-[(1R,5Z)-5-(carbamoylhydrazinylidene)-4-methylcyclohex-3-en-1-yl]propan-2-yl acetate?
The canonical SMILES for 2-[(1R,5Z)-5-(carbamoylhydrazinylidene)-4-methylcyclohex-3-en-1-yl]propan-2-yl acetate is CC(=O)OC(C)(C)[C@@H]1CC=C(C)/C(=N\NC(N)=O)C1.
What is the InChIKey of 2-[(1R,5Z)-5-(carbamoylhydrazinylidene)-4-methylcyclohex-3-en-1-yl]propan-2-yl acetate?
The InChIKey is ODUCHEWAJOSSMP-BXSDCGNMSA-N. The full InChI is InChI=1S/C13H21N3O3/c1-8-5-6-10(13(3,4)19-9(2)17)7-11(8)15-16-12(14)18/h5,10H,6-7H2,1-4H3,(H3,14,16,18)/b15-11-/t10-/m1/s1.
What are the key properties of 2-[(1R,5Z)-5-(carbamoylhydrazinylidene)-4-methylcyclohex-3-en-1-yl]propan-2-yl acetate?
2-[(1R,5Z)-5-(carbamoylhydrazinylidene)-4-methylcyclohex-3-en-1-yl]propan-2-yl acetate has a molecular weight of 267.33 g/mol, XLogP of 1.71, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1R,5Z)-5-(carbamoylhydrazinylidene)-4-methylcyclohex-3-en-1-yl]propan-2-yl acetate is sourced from PubChem (CID 177442860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).