C26H56OSi4 — CID 177443133
[2-[(Z)-1-tert-butyl-3,3-dimethyl-2-trimethylsilyloxybut-1-enyl]-4,5-dimethyl-1-trimethylsilyl-3,6-dihydro-2H-silin-1-yl]-trimethylsilane (PubChem CID 177443133) has the molecular formula C26H56OSi4 and a molecular weight of 497.08 g/mol. Its IUPAC name is [2-[(Z)-1-tert-butyl-3,3-dimethyl-2-trimethylsilyloxybut-1-enyl]-4,5-dimethyl-1-trimethylsilyl-3,6-dihydro-2H-silin-1-yl]-trimethylsilane.
| Compound Name | [2-[(Z)-1-tert-butyl-3,3-dimethyl-2-trimethylsilyloxybut-1-enyl]-4,5-dimethyl-1-trimethylsilyl-3,6-dihydro-2H-silin-1-yl]-trimethylsilane |
|---|---|
| PubChem CID | 177443133 |
| Molecular Formula | C26H56OSi4 |
| Molecular Weight | 497.08 g/mol |
| Exact Mass | 496.34 |
| IUPAC Name | [2-[(Z)-1-tert-butyl-3,3-dimethyl-2-trimethylsilyloxybut-1-enyl]-4,5-dimethyl-1-trimethylsilyl-3,6-dihydro-2H-silin-1-yl]-trimethylsilane |
| SMILES | CC1=C(C)C[Si]([Si](C)(C)C)([Si](C)(C)C)C(/C(=C(\O[Si](C)(C)C)C(C)(C)C)C(C)(C)C)C1 |
| InChI | InChI=1S/C26H56OSi4/c1-20-18-22(31(19-21(20)2,29(12,13)14)30(15,16)17)23(25(3,4)5)24(26(6,7)8)27-28(9,10)11/h22H,18-19H2,1-17H3/b24-23+ |
| InChIKey | MRYVCHWCBNKVPU-WCWDXBQESA-N |
| XLogP | 9.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.08 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|