C17H31NO — CID 177443544
(3R,7S,9Z)-11-ethyl-3,7-dimethyl-1-azacyclotetradec-9-en-2-one (PubChem CID 177443544) has the molecular formula C17H31NO and a molecular weight of 265.44 g/mol. Its IUPAC name is (3R,7S,9Z)-11-ethyl-3,7-dimethyl-1-azacyclotetradec-9-en-2-one.
| Compound Name | (3R,7S,9Z)-11-ethyl-3,7-dimethyl-1-azacyclotetradec-9-en-2-one |
|---|---|
| PubChem CID | 177443544 |
| Molecular Formula | C17H31NO |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.24 |
| IUPAC Name | (3R,7S,9Z)-11-ethyl-3,7-dimethyl-1-azacyclotetradec-9-en-2-one |
| SMILES | CCC1/C=C\C[C@@H](C)CCC[C@@H](C)C(=O)NCCC1 |
| InChI | InChI=1S/C17H31NO/c1-4-16-11-6-9-14(2)8-5-10-15(3)17(19)18-13-7-12-16/h6,11,14-16H,4-5,7-10,12-13H2,1-3H3,(H,18,19)/b11-6-/t14-,15+,16?/m0/s1 |
| InChIKey | FQAKYUHUJNNQPC-FTNCPZRMSA-N |
| XLogP | 4.31 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|