C20H42O3SiSn — CID 177444141
(1Z,7E)-5,5-dimethyl-6-(2-trimethylsilylethoxymethoxy)-1-trimethylstannylnona-1,7-dien-4-ol (PubChem CID 177444141) has the molecular formula C20H42O3SiSn and a molecular weight of 477.35 g/mol. Its IUPAC name is (1Z,7E)-5,5-dimethyl-6-(2-trimethylsilylethoxymethoxy)-1-trimethylstannylnona-1,7-dien-4-ol.
| Compound Name | (1Z,7E)-5,5-dimethyl-6-(2-trimethylsilylethoxymethoxy)-1-trimethylstannylnona-1,7-dien-4-ol |
|---|---|
| PubChem CID | 177444141 |
| Molecular Formula | C20H42O3SiSn |
| Molecular Weight | 477.35 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | (1Z,7E)-5,5-dimethyl-6-(2-trimethylsilylethoxymethoxy)-1-trimethylstannylnona-1,7-dien-4-ol |
| SMILES | C/C=C/C(OCOCC[Si](C)(C)C)C(C)(C)C(O)C/C=C\[Sn](C)(C)C |
| InChI | InChI=1S/C17H33O3Si.3CH3.Sn/c1-8-10-15(18)17(3,4)16(11-9-2)20-14-19-12-13-21(5,6)7;;;;/h1,8-9,11,15-16,18H,10,12-14H2,2-7H3;3*1H3;/b8-1?,11-9+;;;; |
| InChIKey | PBKLMFUZPYFQPB-BFQZZUFQSA-N |
| XLogP | 5.47 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.35 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|