C18H21Cl2NO2S5 — CID 177444524
(12E,14Z)-12,13-dichloro-15-(4-methylphenyl)sulfanyl-14-nitro-1,4,8,11-tetrathiacyclopentadeca-12,14-diene (PubChem CID 177444524) has the molecular formula C18H21Cl2NO2S5 and a molecular weight of 514.61 g/mol. Its IUPAC name is (12E,14Z)-12,13-dichloro-15-(4-methylphenyl)sulfanyl-14-nitro-1,4,8,11-tetrathiacyclopentadeca-12,14-diene.
| Compound Name | (12E,14Z)-12,13-dichloro-15-(4-methylphenyl)sulfanyl-14-nitro-1,4,8,11-tetrathiacyclopentadeca-12,14-diene |
|---|---|
| PubChem CID | 177444524 |
| Molecular Formula | C18H21Cl2NO2S5 |
| Molecular Weight | 514.61 g/mol |
| Exact Mass | 512.96 |
| IUPAC Name | (12E,14Z)-12,13-dichloro-15-(4-methylphenyl)sulfanyl-14-nitro-1,4,8,11-tetrathiacyclopentadeca-12,14-diene |
| SMILES | Cc1ccc(S/C2=C([N+](=O)[O-])/C(Cl)=C(\Cl)SCCSCCCSCCS2)cc1 |
| InChI | InChI=1S/C18H21Cl2NO2S5/c1-13-3-5-14(6-4-13)28-18-16(21(22)23)15(19)17(20)26-11-9-24-7-2-8-25-10-12-27-18/h3-6H,2,7-12H2,1H3/b17-15-,18-16- |
| InChIKey | VWIRXYQKQLUZCF-IQRFGFHNSA-N |
| XLogP | 7.52 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.61 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|