C30H43F2NO7Si — CID 177446065
[(2R,3R,4R,5R)-6-(2,2-difluoroethoxy)-5-nitro-3,4-bis(phenylmethoxy)oxan-2-yl]oxy-tri(propan-2-yl)silane (PubChem CID 177446065) has the molecular formula C30H43F2NO7Si and a molecular weight of 595.76 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-6-(2,2-difluoroethoxy)-5-nitro-3,4-bis(phenylmethoxy)oxan-2-yl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(2R,3R,4R,5R)-6-(2,2-difluoroethoxy)-5-nitro-3,4-bis(phenylmethoxy)oxan-2-yl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 177446065 |
| Molecular Formula | C30H43F2NO7Si |
| Molecular Weight | 595.76 g/mol |
| Exact Mass | 595.28 |
| IUPAC Name | [(2R,3R,4R,5R)-6-(2,2-difluoroethoxy)-5-nitro-3,4-bis(phenylmethoxy)oxan-2-yl]oxy-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](O[C@H]1OC(OCC(F)F)[C@H]([N+](=O)[O-])[C@@H](OCc2ccccc2)[C@H]1OCc1ccccc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C30H43F2NO7Si/c1-20(2)41(21(3)4,22(5)6)40-30-28(37-18-24-15-11-8-12-16-24)27(36-17-23-13-9-7-10-14-23)26(33(34)35)29(39-30)38-19-25(31)32/h7-16,20-22,25-30H,17-19H2,1-6H3/t26-,27-,28-,29?,30-/m1/s1 |
| InChIKey | PUGNIRZRHGWRQF-ODRFSXPYSA-N |
| XLogP | 6.96 |
| TPSA | 89.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.76 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|