C14H14F8IN — CID 177446076
2,6-diethyl-4-(1,1,2,2,3,3,4,4-octafluoro-4-iodobutyl)aniline (PubChem CID 177446076) has the molecular formula C14H14F8IN and a molecular weight of 475.16 g/mol. Its IUPAC name is 2,6-diethyl-4-(1,1,2,2,3,3,4,4-octafluoro-4-iodobutyl)aniline.
| Compound Name | 2,6-diethyl-4-(1,1,2,2,3,3,4,4-octafluoro-4-iodobutyl)aniline |
|---|---|
| PubChem CID | 177446076 |
| Molecular Formula | C14H14F8IN |
| Molecular Weight | 475.16 g/mol |
| Exact Mass | 475.00 |
| IUPAC Name | 2,6-diethyl-4-(1,1,2,2,3,3,4,4-octafluoro-4-iodobutyl)aniline |
| SMILES | CCc1cc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)I)cc(CC)c1N |
| InChI | InChI=1S/C14H14F8IN/c1-3-7-5-9(6-8(4-2)10(7)24)11(15,16)12(17,18)13(19,20)14(21,22)23/h5-6H,3-4,24H2,1-2H3 |
| InChIKey | IJARHAFHMOOJRO-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.16 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|