About 2,5-bis(trifluoromethylsulfonyl)benzene-1,4-diamine
2,5-bis(trifluoromethylsulfonyl)benzene-1,4-diamine (PubChem CID 177446301) has the molecular formula C8H6F6N2O4S2
and a molecular weight of 372.27 g/mol. Its IUPAC name is 2,5-bis(trifluoromethylsulfonyl)benzene-1,4-diamine.
Molecular Properties
| Compound Name | 2,5-bis(trifluoromethylsulfonyl)benzene-1,4-diamine |
| PubChem CID | 177446301 |
| Molecular Formula | C8H6F6N2O4S2 |
| Molecular Weight | 372.27 g/mol |
| Exact Mass | 371.97 |
| IUPAC Name | 2,5-bis(trifluoromethylsulfonyl)benzene-1,4-diamine |
| SMILES | Nc1cc(S(=O)(=O)C(F)(F)F)c(N)cc1S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C8H6F6N2O4S2/c9-7(10,11)21(17,18)5-1-3(15)6(2-4(5)16)22(19,20)8(12,13)14/h1-2H,15-16H2 |
| InChIKey | PVTFEKGUDSFQQE-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.27 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2,5-bis(trifluoromethylsulfonyl)benzene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-bis(trifluoromethylsulfonyl)benzene-1,4-diamine?
The IUPAC name of 2,5-bis(trifluoromethylsulfonyl)benzene-1,4-diamine (CID 177446301) is 2,5-bis(trifluoromethylsulfonyl)benzene-1,4-diamine.
What is the SMILES notation for 2,5-bis(trifluoromethylsulfonyl)benzene-1,4-diamine?
The canonical SMILES for 2,5-bis(trifluoromethylsulfonyl)benzene-1,4-diamine is Nc1cc(S(=O)(=O)C(F)(F)F)c(N)cc1S(=O)(=O)C(F)(F)F.
What is the InChIKey of 2,5-bis(trifluoromethylsulfonyl)benzene-1,4-diamine?
The InChIKey is PVTFEKGUDSFQQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6F6N2O4S2/c9-7(10,11)21(17,18)5-1-3(15)6(2-4(5)16)22(19,20)8(12,13)14/h1-2H,15-16H2.
What are the key properties of 2,5-bis(trifluoromethylsulfonyl)benzene-1,4-diamine?
2,5-bis(trifluoromethylsulfonyl)benzene-1,4-diamine has a molecular weight of 372.27 g/mol, XLogP of 1.44, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis(trifluoromethylsulfonyl)benzene-1,4-diamine is sourced from PubChem (CID 177446301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).