C29H49NO4SSn — CID 177446924
[(Z)-4-[(4-methylphenyl)sulfonyl-[(E)-4-tributylstannylbut-2-enyl]amino]but-2-enyl] acetate (PubChem CID 177446924) has the molecular formula C29H49NO4SSn and a molecular weight of 626.49 g/mol. Its IUPAC name is [(Z)-4-[(4-methylphenyl)sulfonyl-[(E)-4-tributylstannylbut-2-enyl]amino]but-2-enyl] acetate.
| Compound Name | [(Z)-4-[(4-methylphenyl)sulfonyl-[(E)-4-tributylstannylbut-2-enyl]amino]but-2-enyl] acetate |
|---|---|
| PubChem CID | 177446924 |
| Molecular Formula | C29H49NO4SSn |
| Molecular Weight | 626.49 g/mol |
| Exact Mass | 627.24 |
| IUPAC Name | [(Z)-4-[(4-methylphenyl)sulfonyl-[(E)-4-tributylstannylbut-2-enyl]amino]but-2-enyl] acetate |
| SMILES | CCCC[Sn](C/C=C/CN(C/C=C\COC(C)=O)S(=O)(=O)c1ccc(C)cc1)(CCCC)CCCC |
| InChI | InChI=1S/C17H22NO4S.3C4H9.Sn/c1-4-5-12-18(13-6-7-14-22-16(3)19)23(20,21)17-10-8-15(2)9-11-17;3*1-3-4-2;/h4-11H,1,12-14H2,2-3H3;3*1,3-4H2,2H3;/b5-4+,7-6-;;;; |
| InChIKey | KSOPOFDUHYRXMC-BKZIZRQVSA-N |
| XLogP | 7.51 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.49 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|