C26H45NO10Si — CID 177447276
[(2S)-4-[(1E,2S)-1-[tert-butyl(dimethyl)silyl]oxyiminopropan-2-yl]oxy-4-oxobutan-2-yl] (E,4R,5S)-4-(2-methoxyethoxymethoxy)-5-prop-2-enoyloxyhex-2-enoate (PubChem CID 177447276) has the molecular formula C26H45NO10Si and a molecular weight of 559.73 g/mol. Its IUPAC name is [(2S)-4-[(1E,2S)-1-[tert-butyl(dimethyl)silyl]oxyiminopropan-2-yl]oxy-4-oxobutan-2-yl] (E,4R,5S)-4-(2-methoxyethoxymethoxy)-5-prop-2-enoyloxyhex-2-enoate.
| Compound Name | [(2S)-4-[(1E,2S)-1-[tert-butyl(dimethyl)silyl]oxyiminopropan-2-yl]oxy-4-oxobutan-2-yl] (E,4R,5S)-4-(2-methoxyethoxymethoxy)-5-prop-2-enoyloxyhex-2-enoate |
|---|---|
| PubChem CID | 177447276 |
| Molecular Formula | C26H45NO10Si |
| Molecular Weight | 559.73 g/mol |
| Exact Mass | 559.28 |
| IUPAC Name | [(2S)-4-[(1E,2S)-1-[tert-butyl(dimethyl)silyl]oxyiminopropan-2-yl]oxy-4-oxobutan-2-yl] (E,4R,5S)-4-(2-methoxyethoxymethoxy)-5-prop-2-enoyloxyhex-2-enoate |
| SMILES | C=CC(=O)O[C@@H](C)[C@@H](/C=C/C(=O)O[C@@H](C)CC(=O)O[C@@H](C)/C=N/O[Si](C)(C)C(C)(C)C)OCOCCOC |
| InChI | InChI=1S/C26H45NO10Si/c1-11-23(28)36-21(4)22(33-18-32-15-14-31-8)12-13-24(29)34-19(2)16-25(30)35-20(3)17-27-37-38(9,10)26(5,6)7/h11-13,17,19-22H,1,14-16,18H2,2-10H3/b13-12+,27-17+/t19-,20-,21-,22+/m0/s1 |
| InChIKey | NCPDRVDXVMCQPW-IYMYEUNQSA-N |
| XLogP | 3.93 |
| TPSA | 128.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.73 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|