C22H31NO3P+ — CID 177447671
[(1S,2S)-2-(dibenzylamino)-1-hydroxy-3,3-dimethylbutyl]-ethoxy-oxophosphanium (PubChem CID 177447671) has the molecular formula C22H31NO3P+ and a molecular weight of 388.47 g/mol. Its IUPAC name is [(1S,2S)-2-(dibenzylamino)-1-hydroxy-3,3-dimethylbutyl]-ethoxy-oxophosphanium.
| Compound Name | [(1S,2S)-2-(dibenzylamino)-1-hydroxy-3,3-dimethylbutyl]-ethoxy-oxophosphanium |
|---|---|
| PubChem CID | 177447671 |
| Molecular Formula | C22H31NO3P+ |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | [(1S,2S)-2-(dibenzylamino)-1-hydroxy-3,3-dimethylbutyl]-ethoxy-oxophosphanium |
| SMILES | CCO[P+](=O)[C@H](O)[C@@H](N(Cc1ccccc1)Cc1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C22H31NO3P/c1-5-26-27(25)21(24)20(22(2,3)4)23(16-18-12-8-6-9-13-18)17-19-14-10-7-11-15-19/h6-15,20-21,24H,5,16-17H2,1-4H3/q+1/t20-,21+/m1/s1 |
| InChIKey | VSCGWXAAJQANMZ-RTWAWAEBSA-N |
| XLogP | 5.20 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|