C14H15N3O4 — CID 177447921
[(1R,2S)-2-phenylcyclohexyl] 2-diazo-2-nitroacetate (PubChem CID 177447921) has the molecular formula C14H15N3O4 and a molecular weight of 289.29 g/mol. Its IUPAC name is [(1R,2S)-2-phenylcyclohexyl] 2-diazo-2-nitroacetate.
| Compound Name | [(1R,2S)-2-phenylcyclohexyl] 2-diazo-2-nitroacetate |
|---|---|
| PubChem CID | 177447921 |
| Molecular Formula | C14H15N3O4 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | [(1R,2S)-2-phenylcyclohexyl] 2-diazo-2-nitroacetate |
| SMILES | [N-]=[N+]=C(C(=O)O[C@@H]1CCCC[C@H]1c1ccccc1)[N+](=O)[O-] |
| InChI | InChI=1S/C14H15N3O4/c15-16-13(17(19)20)14(18)21-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-3,6-7,11-12H,4-5,8-9H2/t11-,12+/m0/s1 |
| InChIKey | ZKTHDIQKKMHZAB-NWDGAFQWSA-N |
| XLogP | 2.16 |
| TPSA | 105.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|