C14H28O4SSi — CID 177449026
(Z,3R,4R,7S)-3,5-dimethyl-7-methylsulfonyl-4-trimethylsilyloxyoct-5-en-2-one (PubChem CID 177449026) has the molecular formula C14H28O4SSi and a molecular weight of 320.53 g/mol. Its IUPAC name is (Z,3R,4R,7S)-3,5-dimethyl-7-methylsulfonyl-4-trimethylsilyloxyoct-5-en-2-one.
| Compound Name | (Z,3R,4R,7S)-3,5-dimethyl-7-methylsulfonyl-4-trimethylsilyloxyoct-5-en-2-one |
|---|---|
| PubChem CID | 177449026 |
| Molecular Formula | C14H28O4SSi |
| Molecular Weight | 320.53 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | (Z,3R,4R,7S)-3,5-dimethyl-7-methylsulfonyl-4-trimethylsilyloxyoct-5-en-2-one |
| SMILES | CC(=O)[C@H](C)[C@@H](O[Si](C)(C)C)/C(C)=C\[C@H](C)S(C)(=O)=O |
| InChI | InChI=1S/C14H28O4SSi/c1-10(9-11(2)19(5,16)17)14(12(3)13(4)15)18-20(6,7)8/h9,11-12,14H,1-8H3/b10-9-/t11-,12-,14-/m0/s1 |
| InChIKey | WUHPHYDXRORUCR-RYCWWULWSA-N |
| XLogP | 2.81 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.53 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|