C33H35Br2NO4 — CID 177449164
dimethyl 2-(4-bromophenyl)-1-[(4-bromophenyl)methyl]-7,10,10-trimethyl-4,4a,5,10a-tetrahydro-2H-benzo[g]quinoline-3,3-dicarboxylate (PubChem CID 177449164) has the molecular formula C33H35Br2NO4 and a molecular weight of 669.45 g/mol. Its IUPAC name is dimethyl 2-(4-bromophenyl)-1-[(4-bromophenyl)methyl]-7,10,10-trimethyl-4,4a,5,10a-tetrahydro-2H-benzo[g]quinoline-3,3-dicarboxylate.
| Compound Name | dimethyl 2-(4-bromophenyl)-1-[(4-bromophenyl)methyl]-7,10,10-trimethyl-4,4a,5,10a-tetrahydro-2H-benzo[g]quinoline-3,3-dicarboxylate |
|---|---|
| PubChem CID | 177449164 |
| Molecular Formula | C33H35Br2NO4 |
| Molecular Weight | 669.45 g/mol |
| Exact Mass | 667.09 |
| IUPAC Name | dimethyl 2-(4-bromophenyl)-1-[(4-bromophenyl)methyl]-7,10,10-trimethyl-4,4a,5,10a-tetrahydro-2H-benzo[g]quinoline-3,3-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC2Cc3cc(C)ccc3C(C)(C)C2N(Cc2ccc(Br)cc2)C1c1ccc(Br)cc1 |
| InChI | InChI=1S/C33H35Br2NO4/c1-20-6-15-27-23(16-20)17-24-18-33(30(37)39-4,31(38)40-5)29(22-9-13-26(35)14-10-22)36(28(24)32(27,2)3)19-21-7-11-25(34)12-8-21/h6-16,24,28-29H,17-19H2,1-5H3 |
| InChIKey | RUXHAAIYAWNHDX-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.45 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|