C24H36O4 — CID 177449532
diethyl (3Z,3aR,4Z,9aR)-3-(cyclohexylmethylidene)-3a,6,7,8,9,9a-hexahydro-2H-cyclopenta[8]annulene-1,1-dicarboxylate (PubChem CID 177449532) has the molecular formula C24H36O4 and a molecular weight of 388.55 g/mol. Its IUPAC name is diethyl (3Z,3aR,4Z,9aR)-3-(cyclohexylmethylidene)-3a,6,7,8,9,9a-hexahydro-2H-cyclopenta[8]annulene-1,1-dicarboxylate.
| Compound Name | diethyl (3Z,3aR,4Z,9aR)-3-(cyclohexylmethylidene)-3a,6,7,8,9,9a-hexahydro-2H-cyclopenta[8]annulene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 177449532 |
| Molecular Formula | C24H36O4 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | diethyl (3Z,3aR,4Z,9aR)-3-(cyclohexylmethylidene)-3a,6,7,8,9,9a-hexahydro-2H-cyclopenta[8]annulene-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C/C(=C/C2CCCCC2)[C@@H]2/C=C\CCCC[C@H]21 |
| InChI | InChI=1S/C24H36O4/c1-3-27-22(25)24(23(26)28-4-2)17-19(16-18-12-8-7-9-13-18)20-14-10-5-6-11-15-21(20)24/h10,14,16,18,20-21H,3-9,11-13,15,17H2,1-2H3/b14-10-,19-16-/t20-,21+/m0/s1 |
| InChIKey | KEIMPBAIFGUPTA-JUVMLDSLSA-N |
| XLogP | 5.37 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|