C20H31NOSi — CID 177449692
[(1R,2Z,8S)-2-benzylidene-1,3,5,6,7,8-hexahydropyrrolizin-1-yl]oxy-triethylsilane (PubChem CID 177449692) has the molecular formula C20H31NOSi and a molecular weight of 329.56 g/mol. Its IUPAC name is [(1R,2Z,8S)-2-benzylidene-1,3,5,6,7,8-hexahydropyrrolizin-1-yl]oxy-triethylsilane.
| Compound Name | [(1R,2Z,8S)-2-benzylidene-1,3,5,6,7,8-hexahydropyrrolizin-1-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 177449692 |
| Molecular Formula | C20H31NOSi |
| Molecular Weight | 329.56 g/mol |
| Exact Mass | 329.22 |
| IUPAC Name | [(1R,2Z,8S)-2-benzylidene-1,3,5,6,7,8-hexahydropyrrolizin-1-yl]oxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)O[C@@H]1/C(=C\c2ccccc2)CN2CCC[C@@H]12 |
| InChI | InChI=1S/C20H31NOSi/c1-4-23(5-2,6-3)22-20-18(15-17-11-8-7-9-12-17)16-21-14-10-13-19(20)21/h7-9,11-12,15,19-20H,4-6,10,13-14,16H2,1-3H3/b18-15-/t19-,20+/m0/s1 |
| InChIKey | RLRCMPIMTVZUAR-VZCOUXDVSA-N |
| XLogP | 4.94 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.56 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|