C18H21N3O2 — CID 177449894
(1R,4Z,5S)-4-[(1H-indazol-3-ylamino)methylidene]-1,8,8-trimethyl-2-oxabicyclo[3.2.1]octan-3-one (PubChem CID 177449894) has the molecular formula C18H21N3O2 and a molecular weight of 311.38 g/mol. Its IUPAC name is (1R,4Z,5S)-4-[(1H-indazol-3-ylamino)methylidene]-1,8,8-trimethyl-2-oxabicyclo[3.2.1]octan-3-one.
| Compound Name | (1R,4Z,5S)-4-[(1H-indazol-3-ylamino)methylidene]-1,8,8-trimethyl-2-oxabicyclo[3.2.1]octan-3-one |
|---|---|
| PubChem CID | 177449894 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | (1R,4Z,5S)-4-[(1H-indazol-3-ylamino)methylidene]-1,8,8-trimethyl-2-oxabicyclo[3.2.1]octan-3-one |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)OC(=O)/C2=C\Nc1n[nH]c2ccccc12 |
| InChI | InChI=1S/C18H21N3O2/c1-17(2)13-8-9-18(17,3)23-16(22)12(13)10-19-15-11-6-4-5-7-14(11)20-21-15/h4-7,10,13H,8-9H2,1-3H3,(H2,19,20,21)/b12-10-/t13-,18-/m1/s1 |
| InChIKey | NHALAFPKUFRJJT-SZHSMQGVSA-N |
| XLogP | 3.61 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|