C7H5F6NO2 — CID 177450351
(Z)-1,1,1,5,5,5-hexafluoro-4-hydroxy-3-(methyliminomethyl)pent-3-en-2-one (PubChem CID 177450351) has the molecular formula C7H5F6NO2 and a molecular weight of 249.11 g/mol. Its IUPAC name is (Z)-1,1,1,5,5,5-hexafluoro-4-hydroxy-3-(methyliminomethyl)pent-3-en-2-one.
| Compound Name | (Z)-1,1,1,5,5,5-hexafluoro-4-hydroxy-3-(methyliminomethyl)pent-3-en-2-one |
|---|---|
| PubChem CID | 177450351 |
| Molecular Formula | C7H5F6NO2 |
| Molecular Weight | 249.11 g/mol |
| Exact Mass | 249.02 |
| IUPAC Name | (Z)-1,1,1,5,5,5-hexafluoro-4-hydroxy-3-(methyliminomethyl)pent-3-en-2-one |
| SMILES | C/N=C/C(C(=O)C(F)(F)F)=C(/O)C(F)(F)F |
| InChI | InChI=1S/C7H5F6NO2/c1-14-2-3(4(15)6(8,9)10)5(16)7(11,12)13/h2,15H,1H3/b4-3-,14-2+ |
| InChIKey | OJZHVLRNLQYLLQ-XOUHSBLOSA-N |
| XLogP | 2.19 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.11 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|