C24H26N2O6S — CID 177451460
diethyl 2,5-bis[(E)-(4,5-dimethylfuran-2-yl)methylideneamino]thiophene-3,4-dicarboxylate (PubChem CID 177451460) has the molecular formula C24H26N2O6S and a molecular weight of 470.55 g/mol. Its IUPAC name is diethyl 2,5-bis[(E)-(4,5-dimethylfuran-2-yl)methylideneamino]thiophene-3,4-dicarboxylate.
| Compound Name | diethyl 2,5-bis[(E)-(4,5-dimethylfuran-2-yl)methylideneamino]thiophene-3,4-dicarboxylate |
|---|---|
| PubChem CID | 177451460 |
| Molecular Formula | C24H26N2O6S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | diethyl 2,5-bis[(E)-(4,5-dimethylfuran-2-yl)methylideneamino]thiophene-3,4-dicarboxylate |
| SMILES | CCOC(=O)c1c(/N=C/c2cc(C)c(C)o2)sc(/N=C/c2cc(C)c(C)o2)c1C(=O)OCC |
| InChI | InChI=1S/C24H26N2O6S/c1-7-29-23(27)19-20(24(28)30-8-2)22(26-12-18-10-14(4)16(6)32-18)33-21(19)25-11-17-9-13(3)15(5)31-17/h9-12H,7-8H2,1-6H3/b25-11+,26-12+ |
| InChIKey | RZZVVDCKOUXLDZ-KOZSXFMUSA-N |
| XLogP | 6.02 |
| TPSA | 103.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|