About (2E)-2-benzylidene-5,7-dichloro-3H-1-benzofuran-3-ol
(2E)-2-benzylidene-5,7-dichloro-3H-1-benzofuran-3-ol (PubChem CID 177451465) has the molecular formula C15H10Cl2O2
and a molecular weight of 293.15 g/mol. Its IUPAC name is (2E)-2-benzylidene-5,7-dichloro-3H-1-benzofuran-3-ol.
Molecular Properties
| Compound Name | (2E)-2-benzylidene-5,7-dichloro-3H-1-benzofuran-3-ol |
| PubChem CID | 177451465 |
| Molecular Formula | C15H10Cl2O2 |
| Molecular Weight | 293.15 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | (2E)-2-benzylidene-5,7-dichloro-3H-1-benzofuran-3-ol |
| SMILES | OC1/C(=C\c2ccccc2)Oc2c(Cl)cc(Cl)cc21 |
| InChI | InChI=1S/C15H10Cl2O2/c16-10-7-11-14(18)13(19-15(11)12(17)8-10)6-9-4-2-1-3-5-9/h1-8,14,18H/b13-6+ |
| InChIKey | SWYNNJMYXAGWPD-AWNIVKPZSA-N |
| XLogP | 4.46 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.15 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2E)-2-benzylidene-5,7-dichloro-3H-1-benzofuran-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-benzylidene-5,7-dichloro-3H-1-benzofuran-3-ol?
The IUPAC name of (2E)-2-benzylidene-5,7-dichloro-3H-1-benzofuran-3-ol (CID 177451465) is (2E)-2-benzylidene-5,7-dichloro-3H-1-benzofuran-3-ol.
What is the SMILES notation for (2E)-2-benzylidene-5,7-dichloro-3H-1-benzofuran-3-ol?
The canonical SMILES for (2E)-2-benzylidene-5,7-dichloro-3H-1-benzofuran-3-ol is OC1/C(=C\c2ccccc2)Oc2c(Cl)cc(Cl)cc21.
What is the InChIKey of (2E)-2-benzylidene-5,7-dichloro-3H-1-benzofuran-3-ol?
The InChIKey is SWYNNJMYXAGWPD-AWNIVKPZSA-N. The full InChI is InChI=1S/C15H10Cl2O2/c16-10-7-11-14(18)13(19-15(11)12(17)8-10)6-9-4-2-1-3-5-9/h1-8,14,18H/b13-6+.
What are the key properties of (2E)-2-benzylidene-5,7-dichloro-3H-1-benzofuran-3-ol?
(2E)-2-benzylidene-5,7-dichloro-3H-1-benzofuran-3-ol has a molecular weight of 293.15 g/mol, XLogP of 4.46, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-benzylidene-5,7-dichloro-3H-1-benzofuran-3-ol is sourced from PubChem (CID 177451465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).