About ethyl (E)-2,2-difluoro-4-(morpholin-4-ylsulfamoyl)-4-phenylbut-3-enoate
ethyl (E)-2,2-difluoro-4-(morpholin-4-ylsulfamoyl)-4-phenylbut-3-enoate (PubChem CID 177451670) has the molecular formula C16H20F2N2O5S
and a molecular weight of 390.41 g/mol. Its IUPAC name is ethyl (E)-2,2-difluoro-4-(morpholin-4-ylsulfamoyl)-4-phenylbut-3-enoate.
Molecular Properties
| Compound Name | ethyl (E)-2,2-difluoro-4-(morpholin-4-ylsulfamoyl)-4-phenylbut-3-enoate |
| PubChem CID | 177451670 |
| Molecular Formula | C16H20F2N2O5S |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | ethyl (E)-2,2-difluoro-4-(morpholin-4-ylsulfamoyl)-4-phenylbut-3-enoate |
| SMILES | CCOC(=O)C(F)(F)/C=C(\c1ccccc1)S(=O)(=O)NN1CCOCC1 |
| InChI | InChI=1S/C16H20F2N2O5S/c1-2-25-15(21)16(17,18)12-14(13-6-4-3-5-7-13)26(22,23)19-20-8-10-24-11-9-20/h3-7,12,19H,2,8-11H2,1H3/b14-12+ |
| InChIKey | BHODEQSOBPLIBR-WYMLVPIESA-N |
| XLogP | 1.39 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl (E)-2,2-difluoro-4-(morpholin-4-ylsulfamoyl)-4-phenylbut-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (E)-2,2-difluoro-4-(morpholin-4-ylsulfamoyl)-4-phenylbut-3-enoate?
The IUPAC name of ethyl (E)-2,2-difluoro-4-(morpholin-4-ylsulfamoyl)-4-phenylbut-3-enoate (CID 177451670) is ethyl (E)-2,2-difluoro-4-(morpholin-4-ylsulfamoyl)-4-phenylbut-3-enoate.
What is the SMILES notation for ethyl (E)-2,2-difluoro-4-(morpholin-4-ylsulfamoyl)-4-phenylbut-3-enoate?
The canonical SMILES for ethyl (E)-2,2-difluoro-4-(morpholin-4-ylsulfamoyl)-4-phenylbut-3-enoate is CCOC(=O)C(F)(F)/C=C(\c1ccccc1)S(=O)(=O)NN1CCOCC1.
What is the InChIKey of ethyl (E)-2,2-difluoro-4-(morpholin-4-ylsulfamoyl)-4-phenylbut-3-enoate?
The InChIKey is BHODEQSOBPLIBR-WYMLVPIESA-N. The full InChI is InChI=1S/C16H20F2N2O5S/c1-2-25-15(21)16(17,18)12-14(13-6-4-3-5-7-13)26(22,23)19-20-8-10-24-11-9-20/h3-7,12,19H,2,8-11H2,1H3/b14-12+.
What are the key properties of ethyl (E)-2,2-difluoro-4-(morpholin-4-ylsulfamoyl)-4-phenylbut-3-enoate?
ethyl (E)-2,2-difluoro-4-(morpholin-4-ylsulfamoyl)-4-phenylbut-3-enoate has a molecular weight of 390.41 g/mol, XLogP of 1.39, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (E)-2,2-difluoro-4-(morpholin-4-ylsulfamoyl)-4-phenylbut-3-enoate is sourced from PubChem (CID 177451670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).