About methyl 1,3-bis[2,6-di(propan-2-yl)phenyl]-5-iodotriazol-3-ium-4-carboxylate
methyl 1,3-bis[2,6-di(propan-2-yl)phenyl]-5-iodotriazol-3-ium-4-carboxylate (PubChem CID 177451758) has the molecular formula C28H37IN3O2+
and a molecular weight of 574.53 g/mol. Its IUPAC name is methyl 1,3-bis[2,6-di(propan-2-yl)phenyl]-5-iodotriazol-3-ium-4-carboxylate.
Molecular Properties
| Compound Name | methyl 1,3-bis[2,6-di(propan-2-yl)phenyl]-5-iodotriazol-3-ium-4-carboxylate |
| PubChem CID | 177451758 |
| Molecular Formula | C28H37IN3O2+ |
| Molecular Weight | 574.53 g/mol |
| Exact Mass | 574.19 |
| IUPAC Name | methyl 1,3-bis[2,6-di(propan-2-yl)phenyl]-5-iodotriazol-3-ium-4-carboxylate |
| SMILES | COC(=O)c1c(I)n(-c2c(C(C)C)cccc2C(C)C)n[n+]1-c1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C28H37IN3O2/c1-16(2)20-12-10-13-21(17(3)4)24(20)31-26(28(33)34-9)27(29)32(30-31)25-22(18(5)6)14-11-15-23(25)19(7)8/h10-19H,1-9H3/q+1 |
| InChIKey | VDDQCPAVEOPQBW-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 574.53 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 1,3-bis[2,6-di(propan-2-yl)phenyl]-5-iodotriazol-3-ium-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1,3-bis[2,6-di(propan-2-yl)phenyl]-5-iodotriazol-3-ium-4-carboxylate?
The IUPAC name of methyl 1,3-bis[2,6-di(propan-2-yl)phenyl]-5-iodotriazol-3-ium-4-carboxylate (CID 177451758) is methyl 1,3-bis[2,6-di(propan-2-yl)phenyl]-5-iodotriazol-3-ium-4-carboxylate.
What is the SMILES notation for methyl 1,3-bis[2,6-di(propan-2-yl)phenyl]-5-iodotriazol-3-ium-4-carboxylate?
The canonical SMILES for methyl 1,3-bis[2,6-di(propan-2-yl)phenyl]-5-iodotriazol-3-ium-4-carboxylate is COC(=O)c1c(I)n(-c2c(C(C)C)cccc2C(C)C)n[n+]1-c1c(C(C)C)cccc1C(C)C.
What is the InChIKey of methyl 1,3-bis[2,6-di(propan-2-yl)phenyl]-5-iodotriazol-3-ium-4-carboxylate?
The InChIKey is VDDQCPAVEOPQBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H37IN3O2/c1-16(2)20-12-10-13-21(17(3)4)24(20)31-26(28(33)34-9)27(29)32(30-31)25-22(18(5)6)14-11-15-23(25)19(7)8/h10-19H,1-9H3/q+1.
What are the key properties of methyl 1,3-bis[2,6-di(propan-2-yl)phenyl]-5-iodotriazol-3-ium-4-carboxylate?
methyl 1,3-bis[2,6-di(propan-2-yl)phenyl]-5-iodotriazol-3-ium-4-carboxylate has a molecular weight of 574.53 g/mol, XLogP of 7.03, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1,3-bis[2,6-di(propan-2-yl)phenyl]-5-iodotriazol-3-ium-4-carboxylate is sourced from PubChem (CID 177451758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).