C31H24N4O2 — CID 177452047
[(1R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 9,10-bis(dicyanomethylidene)anthracene-2-carboxylate (PubChem CID 177452047) has the molecular formula C31H24N4O2 and a molecular weight of 484.56 g/mol. Its IUPAC name is [(1R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 9,10-bis(dicyanomethylidene)anthracene-2-carboxylate.
| Compound Name | [(1R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 9,10-bis(dicyanomethylidene)anthracene-2-carboxylate |
|---|---|
| PubChem CID | 177452047 |
| Molecular Formula | C31H24N4O2 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | [(1R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 9,10-bis(dicyanomethylidene)anthracene-2-carboxylate |
| SMILES | CC1(C)C2CC[C@@]1(C)C(OC(=O)c1ccc3c(=C(C#N)C#N)c4ccccc4c(=C(C#N)C#N)c3c1)C2 |
| InChI | InChI=1S/C31H24N4O2/c1-30(2)21-10-11-31(30,3)26(13-21)37-29(36)18-8-9-24-25(12-18)28(20(16-34)17-35)23-7-5-4-6-22(23)27(24)19(14-32)15-33/h4-9,12,21,26H,10-11,13H2,1-3H3/t21?,26?,31-/m0/s1 |
| InChIKey | WMVQPTJTPVKYEX-HPRUNSKJSA-N |
| XLogP | 4.76 |
| TPSA | 121.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|