C31H38O9 — CID 177453256
methyl 2-[(1R,2R,5R,6R,12R,13R,15R,17R,18R)-13-acetyloxy-12-ethoxy-6-(furan-3-yl)-1,5,15-trimethyl-8,14-dioxo-7-oxapentacyclo[13.2.1.02,11.05,10.013,17]octadec-10-en-18-yl]acetate (PubChem CID 177453256) has the molecular formula C31H38O9 and a molecular weight of 554.64 g/mol. Its IUPAC name is methyl 2-[(1R,2R,5R,6R,12R,13R,15R,17R,18R)-13-acetyloxy-12-ethoxy-6-(furan-3-yl)-1,5,15-trimethyl-8,14-dioxo-7-oxapentacyclo[13.2.1.02,11.05,10.013,17]octadec-10-en-18-yl]acetate.
| Compound Name | methyl 2-[(1R,2R,5R,6R,12R,13R,15R,17R,18R)-13-acetyloxy-12-ethoxy-6-(furan-3-yl)-1,5,15-trimethyl-8,14-dioxo-7-oxapentacyclo[13.2.1.02,11.05,10.013,17]octadec-10-en-18-yl]acetate |
|---|---|
| PubChem CID | 177453256 |
| Molecular Formula | C31H38O9 |
| Molecular Weight | 554.64 g/mol |
| Exact Mass | 554.25 |
| IUPAC Name | methyl 2-[(1R,2R,5R,6R,12R,13R,15R,17R,18R)-13-acetyloxy-12-ethoxy-6-(furan-3-yl)-1,5,15-trimethyl-8,14-dioxo-7-oxapentacyclo[13.2.1.02,11.05,10.013,17]octadec-10-en-18-yl]acetate |
| SMILES | CCO[C@@H]1C2=C3CC(=O)O[C@@H](c4ccoc4)[C@]3(C)CC[C@@H]2[C@]2(C)[C@@H](CC(=O)OC)C3(C)C[C@H]2[C@]1(OC(C)=O)C3=O |
| InChI | InChI=1S/C31H38O9/c1-7-38-26-24-18(8-10-28(3)19(24)12-23(34)39-25(28)17-9-11-37-15-17)30(5)20(13-22(33)36-6)29(4)14-21(30)31(26,27(29)35)40-16(2)32/h9,11,15,18,20-21,25-26H,7-8,10,12-14H2,1-6H3/t18-,20-,21+,25-,26+,28+,29?,30+,31+/m0/s1 |
| InChIKey | ZFONNNKFZOBSSD-FESSTQTQSA-N |
| XLogP | 4.50 |
| TPSA | 118.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.64 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|