C17H26O8 — CID 177453367
ethyl (9R,10R,11R)-9-hydroxy-3,3,9-trimethyl-1,5-dioxo-11-propan-2-yl-2,4,7-trioxaspiro[5.5]undecane-10-carboxylate (PubChem CID 177453367) has the molecular formula C17H26O8 and a molecular weight of 358.39 g/mol. Its IUPAC name is ethyl (9R,10R,11R)-9-hydroxy-3,3,9-trimethyl-1,5-dioxo-11-propan-2-yl-2,4,7-trioxaspiro[5.5]undecane-10-carboxylate.
| Compound Name | ethyl (9R,10R,11R)-9-hydroxy-3,3,9-trimethyl-1,5-dioxo-11-propan-2-yl-2,4,7-trioxaspiro[5.5]undecane-10-carboxylate |
|---|---|
| PubChem CID | 177453367 |
| Molecular Formula | C17H26O8 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | ethyl (9R,10R,11R)-9-hydroxy-3,3,9-trimethyl-1,5-dioxo-11-propan-2-yl-2,4,7-trioxaspiro[5.5]undecane-10-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H](C(C)C)C2(OC[C@]1(C)O)C(=O)OC(C)(C)OC2=O |
| InChI | InChI=1S/C17H26O8/c1-7-22-12(18)11-10(9(2)3)17(23-8-16(11,6)21)13(19)24-15(4,5)25-14(17)20/h9-11,21H,7-8H2,1-6H3/t10-,11+,16+/m1/s1 |
| InChIKey | QLOJOOTWFVGCEZ-GDLVEWKHSA-N |
| XLogP | 0.79 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|