C31H34O6Si — CID 177453453
dimethyl (1S,2Z,4S,8E,10E)-9-methoxy-1-phenyl-10-trimethylsilyl-18-oxatetracyclo[9.6.1.04,8.012,17]octadeca-2,8,10,12,14,16-hexaene-2,3-dicarboxylate (PubChem CID 177453453) has the molecular formula C31H34O6Si and a molecular weight of 530.69 g/mol. Its IUPAC name is dimethyl (1S,2Z,4S,8E,10E)-9-methoxy-1-phenyl-10-trimethylsilyl-18-oxatetracyclo[9.6.1.04,8.012,17]octadeca-2,8,10,12,14,16-hexaene-2,3-dicarboxylate.
| Compound Name | dimethyl (1S,2Z,4S,8E,10E)-9-methoxy-1-phenyl-10-trimethylsilyl-18-oxatetracyclo[9.6.1.04,8.012,17]octadeca-2,8,10,12,14,16-hexaene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 177453453 |
| Molecular Formula | C31H34O6Si |
| Molecular Weight | 530.69 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | dimethyl (1S,2Z,4S,8E,10E)-9-methoxy-1-phenyl-10-trimethylsilyl-18-oxatetracyclo[9.6.1.04,8.012,17]octadeca-2,8,10,12,14,16-hexaene-2,3-dicarboxylate |
| SMILES | COC(=O)/C1=C(\C(=O)OC)[C@@]2(c3ccccc3)O/C(=C([Si](C)(C)C)\C(OC)=C3\CCC[C@H]13)c1ccccc12 |
| InChI | InChI=1S/C31H34O6Si/c1-34-26-21-17-12-16-20(21)24(29(32)35-2)25(30(33)36-3)31(19-13-8-7-9-14-19)23-18-11-10-15-22(23)27(37-31)28(26)38(4,5)6/h7-11,13-15,18,20H,12,16-17H2,1-6H3/b25-24+,26-21+,28-27+/t20-,31-/m0/s1 |
| InChIKey | AZUWDSULOZKXTO-SKBSRFGXSA-N |
| XLogP | 5.91 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.69 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|