C28H54O5SiSn — CID 177453522
diethyl (2S,3R,4R)-4-(tributylstannylmethyl)-2-trimethylsilyl-1-oxaspiro[2.4]heptane-6,6-dicarboxylate (PubChem CID 177453522) has the molecular formula C28H54O5SiSn and a molecular weight of 617.53 g/mol. Its IUPAC name is diethyl (2S,3R,4R)-4-(tributylstannylmethyl)-2-trimethylsilyl-1-oxaspiro[2.4]heptane-6,6-dicarboxylate.
| Compound Name | diethyl (2S,3R,4R)-4-(tributylstannylmethyl)-2-trimethylsilyl-1-oxaspiro[2.4]heptane-6,6-dicarboxylate |
|---|---|
| PubChem CID | 177453522 |
| Molecular Formula | C28H54O5SiSn |
| Molecular Weight | 617.53 g/mol |
| Exact Mass | 618.28 |
| IUPAC Name | diethyl (2S,3R,4R)-4-(tributylstannylmethyl)-2-trimethylsilyl-1-oxaspiro[2.4]heptane-6,6-dicarboxylate |
| SMILES | CCCC[Sn](CCCC)(CCCC)C[C@@H]1CC(C(=O)OCC)(C(=O)OCC)C[C@@]12O[C@H]2[Si](C)(C)C |
| InChI | InChI=1S/C16H27O5Si.3C4H9.Sn/c1-7-19-12(17)15(13(18)20-8-2)9-11(3)16(10-15)14(21-16)22(4,5)6;3*1-3-4-2;/h11,14H,3,7-10H2,1-2,4-6H3;3*1,3-4H2,2H3;/t11-,14+,16-;;;;/m1..../s1 |
| InChIKey | ZCHMVCPIDQRINL-RVIICKPQSA-N |
| XLogP | 7.37 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.53 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|