C32H24BFN2O2S4 — CID 177453940
1-fluoro-6,13-bis[4-methyl-5-(3-methylthiophen-2-yl)thiophen-2-yl]-2,17-dioxa-9-aza-10-azonia-1-boranuidatetracyclo[8.7.0.03,8.011,16]heptadeca-3(8),4,6,9,11(16),12,14-heptaene (PubChem CID 177453940) has the molecular formula C32H24BFN2O2S4 and a molecular weight of 626.63 g/mol. Its IUPAC name is 1-fluoro-6,13-bis[4-methyl-5-(3-methylthiophen-2-yl)thiophen-2-yl]-2,17-dioxa-9-aza-10-azonia-1-boranuidatetracyclo[8.7.0.03,8.011,16]heptadeca-3(8),4,6,9,11(16),12,14-heptaene.
| Compound Name | 1-fluoro-6,13-bis[4-methyl-5-(3-methylthiophen-2-yl)thiophen-2-yl]-2,17-dioxa-9-aza-10-azonia-1-boranuidatetracyclo[8.7.0.03,8.011,16]heptadeca-3(8),4,6,9,11(16),12,14-heptaene |
|---|---|
| PubChem CID | 177453940 |
| Molecular Formula | C32H24BFN2O2S4 |
| Molecular Weight | 626.63 g/mol |
| Exact Mass | 626.08 |
| IUPAC Name | 1-fluoro-6,13-bis[4-methyl-5-(3-methylthiophen-2-yl)thiophen-2-yl]-2,17-dioxa-9-aza-10-azonia-1-boranuidatetracyclo[8.7.0.03,8.011,16]heptadeca-3(8),4,6,9,11(16),12,14-heptaene |
| SMILES | Cc1ccsc1-c1sc(-c2ccc3c(c2)N=[N+]2c4cc(-c5cc(C)c(-c6sccc6C)s5)ccc4O[B-]2(F)O3)cc1C |
| InChI | InChI=1S/C32H24BFN2O2S4/c1-17-9-11-39-29(17)31-19(3)13-27(41-31)21-5-7-25-23(15-21)35-36-24-16-22(6-8-26(24)38-33(36,34)37-25)28-14-20(4)32(42-28)30-18(2)10-12-40-30/h5-16H,1-4H3 |
| InChIKey | FMMNUCLQPNOFJT-UHFFFAOYSA-N |
| XLogP | 11.45 |
| TPSA | 33.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.63 |
| LogP ≤ 5 | 11.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|