C37H28Cl2O5 — CID 177454316
dimethyl 5-(4-chlorophenyl)-6-[2-(4-chlorophenyl)ethynyl]-3-methyl-2-phenyl-7,9-dihydro-2H-cyclopenta[h]chromene-8,8-dicarboxylate (PubChem CID 177454316) has the molecular formula C37H28Cl2O5 and a molecular weight of 623.53 g/mol. Its IUPAC name is dimethyl 5-(4-chlorophenyl)-6-[2-(4-chlorophenyl)ethynyl]-3-methyl-2-phenyl-7,9-dihydro-2H-cyclopenta[h]chromene-8,8-dicarboxylate.
| Compound Name | dimethyl 5-(4-chlorophenyl)-6-[2-(4-chlorophenyl)ethynyl]-3-methyl-2-phenyl-7,9-dihydro-2H-cyclopenta[h]chromene-8,8-dicarboxylate |
|---|---|
| PubChem CID | 177454316 |
| Molecular Formula | C37H28Cl2O5 |
| Molecular Weight | 623.53 g/mol |
| Exact Mass | 622.13 |
| IUPAC Name | dimethyl 5-(4-chlorophenyl)-6-[2-(4-chlorophenyl)ethynyl]-3-methyl-2-phenyl-7,9-dihydro-2H-cyclopenta[h]chromene-8,8-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)Cc2c(C#Cc3ccc(Cl)cc3)c(-c3ccc(Cl)cc3)c3c(c2C1)OC(c1ccccc1)C(C)=C3 |
| InChI | InChI=1S/C37H28Cl2O5/c1-22-19-29-32(24-12-16-27(39)17-13-24)28(18-11-23-9-14-26(38)15-10-23)30-20-37(35(40)42-2,36(41)43-3)21-31(30)34(29)44-33(22)25-7-5-4-6-8-25/h4-10,12-17,19,33H,20-21H2,1-3H3 |
| InChIKey | XLHJIXUBXNNZIW-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.53 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|