C26H32Br3I3O — CID 177454647
2-bromo-6-[[(1S,2S,3S,6Z)-3-bromo-2-[2-[(1R,3R,6Z)-3-bromo-6-(iodomethylidene)-2,2-dimethylcyclohexyl]ethyl]-6-(iodomethylidene)-2-methylcyclohexyl]methyl]-4-iodophenol (PubChem CID 177454647) has the molecular formula C26H32Br3I3O and a molecular weight of 980.96 g/mol. Its IUPAC name is 2-bromo-6-[[(1S,2S,3S,6Z)-3-bromo-2-[2-[(1R,3R,6Z)-3-bromo-6-(iodomethylidene)-2,2-dimethylcyclohexyl]ethyl]-6-(iodomethylidene)-2-methylcyclohexyl]methyl]-4-iodophenol.
| Compound Name | 2-bromo-6-[[(1S,2S,3S,6Z)-3-bromo-2-[2-[(1R,3R,6Z)-3-bromo-6-(iodomethylidene)-2,2-dimethylcyclohexyl]ethyl]-6-(iodomethylidene)-2-methylcyclohexyl]methyl]-4-iodophenol |
|---|---|
| PubChem CID | 177454647 |
| Molecular Formula | C26H32Br3I3O |
| Molecular Weight | 980.96 g/mol |
| Exact Mass | 977.71 |
| IUPAC Name | 2-bromo-6-[[(1S,2S,3S,6Z)-3-bromo-2-[2-[(1R,3R,6Z)-3-bromo-6-(iodomethylidene)-2,2-dimethylcyclohexyl]ethyl]-6-(iodomethylidene)-2-methylcyclohexyl]methyl]-4-iodophenol |
| SMILES | CC1(C)[C@H](Br)CC/C(=C/I)[C@@H]1CC[C@@]1(C)[C@H](Cc2cc(I)cc(Br)c2O)/C(=C\I)CC[C@@H]1Br |
| InChI | InChI=1S/C26H32Br3I3O/c1-25(2)19(15(13-30)4-6-22(25)28)8-9-26(3)20(16(14-31)5-7-23(26)29)11-17-10-18(32)12-21(27)24(17)33/h10,12-14,19-20,22-23,33H,4-9,11H2,1-3H3/b15-13-,16-14-/t19-,20+,22+,23-,26-/m0/s1 |
| InChIKey | TUNPYABDHNSBNC-UNGDKNEBSA-N |
| XLogP | 11.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 980.96 |
| LogP ≤ 5 | 11.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|