C13H16Cl2O9S — CID 177454705
[(1R,2S,3R,4S,5R,6S,8S,10S)-1,10-dichloro-5,8-dihydroxy-11,11-dimethoxy-9-oxo-7-oxatetracyclo[6.3.0.02,6.03,10]undecan-4-yl] methanesulfonate (PubChem CID 177454705) has the molecular formula C13H16Cl2O9S and a molecular weight of 419.24 g/mol. Its IUPAC name is [(1R,2S,3R,4S,5R,6S,8S,10S)-1,10-dichloro-5,8-dihydroxy-11,11-dimethoxy-9-oxo-7-oxatetracyclo[6.3.0.02,6.03,10]undecan-4-yl] methanesulfonate.
| Compound Name | [(1R,2S,3R,4S,5R,6S,8S,10S)-1,10-dichloro-5,8-dihydroxy-11,11-dimethoxy-9-oxo-7-oxatetracyclo[6.3.0.02,6.03,10]undecan-4-yl] methanesulfonate |
|---|---|
| PubChem CID | 177454705 |
| Molecular Formula | C13H16Cl2O9S |
| Molecular Weight | 419.24 g/mol |
| Exact Mass | 417.99 |
| IUPAC Name | [(1R,2S,3R,4S,5R,6S,8S,10S)-1,10-dichloro-5,8-dihydroxy-11,11-dimethoxy-9-oxo-7-oxatetracyclo[6.3.0.02,6.03,10]undecan-4-yl] methanesulfonate |
| SMILES | COC1(OC)[C@@]2(Cl)C(=O)[C@]3(O)O[C@@H]4[C@@H](O)[C@@H](OS(C)(=O)=O)[C@H]2[C@@H]4[C@]13Cl |
| InChI | InChI=1S/C13H16Cl2O9S/c1-21-13(22-2)10(14)4-5-7(6(16)8(4)24-25(3,19)20)23-12(18,9(10)17)11(5,13)15/h4-8,16,18H,1-3H3/t4-,5+,6-,7+,8+,10+,11-,12+/m1/s1 |
| InChIKey | LUHVUQKBUGTZHD-MKZASSMWSA-N |
| XLogP | -1.43 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.24 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|